| Name | Furfuryl thiopropionate |
| Synonyms | FEMA 3347 LABOTEST-BB LT00847921 Furfuryl thiopropionate FURFURYL THIOPROPIONATE FURFURYL PROPANETHIOATE S-FURFURYL PROPANETHIOATE S-FURFURYL THIOPROPIONATE THIOPROPIONIC ACID S-FURFURYL ESTER Thiopropionic acid S-furfuryl ester S-(furan-2-ylmethyl) propanethioate propanethioicacid,s-(2-furanylmethyl)ester |
| CAS | 59020-85-8 |
| EINECS | 261-562-2 |
| InChI | InChI=1/C8H10O2S/c1-2-8(9)11-6-7-4-3-5-10-7/h3-5H,2,6H2,1H3 |
| Molecular Formula | C8H10O2S |
| Molar Mass | 170.23 |
| Density | 1.108 g/mL at 25 °C (lit.) |
| Boling Point | 219°C |
| Flash Point | 208°F |
| JECFA Number | 1075 |
| Vapor Presure | 0.0523mmHg at 25°C |
| Appearance | clear liquid |
| Color | White to Yellow to Green |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.518(lit.) |
| Physical and Chemical Properties | Colorless to light yellow liquid, cocoa and cooked meat like aroma. Boiling point 95~97 degrees C (1333Pa). Natural products are present in coffee and the like. |
| Use | Used as food flavor |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| UN IDs | UN 3334 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29321900 |
| Raw Materials | Propionic acid |
| FEMA | 3347 | FURFURYL THIOPROPIONATE |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| introduction | bran thiopropionate is a carboxylate derivative and can be used as an edible essence. |
| toxicity | GRAS(FEMA). |
| usage limit | (FEMA): soft drinks, cold drinks, candy, baked goods, all 1.0 mg/kg. |
| use | GB 2760-1996 specified as temporarily allowed food spices. Used as food essence |